C14H18Cl2N2OS — CID 120657138
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-chlorophenyl)sulfanylethanone;hydrochloride (PubChem CID 120657138) has the molecular formula C14H18Cl2N2OS and a molecular weight of 333.28 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-chlorophenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-chlorophenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 120657138 |
| Molecular Formula | C14H18Cl2N2OS |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-chlorophenyl)sulfanylethanone;hydrochloride |
| SMILES | Cl.O=C(CSc1ccccc1Cl)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C14H17ClN2OS.ClH/c15-12-3-1-2-4-13(12)19-9-14(18)17-7-10-5-16-6-11(10)8-17;/h1-4,10-11,16H,5-9H2;1H/t10-,11+; |
| InChIKey | GGIRDRLSLDBXPC-NJJJQDLFSA-N |
| XLogP | 2.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |