C15H20BrClN2OS — CID 120655926
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2-methylphenyl)sulfanylethanone;hydrochloride (PubChem CID 120655926) has the molecular formula C15H20BrClN2OS and a molecular weight of 391.76 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2-methylphenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2-methylphenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 120655926 |
| Molecular Formula | C15H20BrClN2OS |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2-methylphenyl)sulfanylethanone;hydrochloride |
| SMILES | Cc1cc(Br)ccc1SCC(=O)N1C[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C15H19BrN2OS.ClH/c1-10-4-13(16)2-3-14(10)20-9-15(19)18-7-11-5-17-6-12(11)8-18;/h2-4,11-12,17H,5-9H2,1H3;1H/t11-,12+; |
| InChIKey | MSKZYFIHOMMKGE-IWKKHLOMSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |