C14H20BrClN2OS — CID 119470905
2-(4-bromo-2-methylphenyl)sulfanyl-1-(2-methylpiperazin-1-yl)ethanone;hydrochloride (PubChem CID 119470905) has the molecular formula C14H20BrClN2OS and a molecular weight of 379.75 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-1-(2-methylpiperazin-1-yl)ethanone;hydrochloride.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-1-(2-methylpiperazin-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119470905 |
| Molecular Formula | C14H20BrClN2OS |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-1-(2-methylpiperazin-1-yl)ethanone;hydrochloride |
| SMILES | Cc1cc(Br)ccc1SCC(=O)N1CCNCC1C.Cl |
| InChI | InChI=1S/C14H19BrN2OS.ClH/c1-10-7-12(15)3-4-13(10)19-9-14(18)17-6-5-16-8-11(17)2;/h3-4,7,11,16H,5-6,8-9H2,1-2H3;1H |
| InChIKey | QOPQOXBNUAIHKU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |