C16H22BrClN2OS — CID 120659643
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2,5-dimethylphenyl)sulfanylethanone;hydrochloride (PubChem CID 120659643) has the molecular formula C16H22BrClN2OS and a molecular weight of 405.79 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2,5-dimethylphenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2,5-dimethylphenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 120659643 |
| Molecular Formula | C16H22BrClN2OS |
| Molecular Weight | 405.79 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromo-2,5-dimethylphenyl)sulfanylethanone;hydrochloride |
| SMILES | Cc1cc(SCC(=O)N2C[C@H]3CNC[C@H]3C2)c(C)cc1Br.Cl |
| InChI | InChI=1S/C16H21BrN2OS.ClH/c1-10-4-15(11(2)3-14(10)17)21-9-16(20)19-7-12-5-18-6-13(12)8-19;/h3-4,12-13,18H,5-9H2,1-2H3;1H/t12-,13+; |
| InChIKey | XKUKALQRBJTGBV-OEEJBDNKSA-N |
| XLogP | 3.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |