C14H19BrN2OS — CID 119450666
2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyrrolidin-3-ylacetamide (PubChem CID 119450666) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyrrolidin-3-ylacetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyrrolidin-3-ylacetamide |
|---|---|
| PubChem CID | 119450666 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-pyrrolidin-3-ylacetamide |
| SMILES | Cc1cc(SCC(=O)NC2CCNC2)c(C)cc1Br |
| InChI | InChI=1S/C14H19BrN2OS/c1-9-6-13(10(2)5-12(9)15)19-8-14(18)17-11-3-4-16-7-11/h5-6,11,16H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | FMCJKFNAFDCKGO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |