C14H15BrN2O3S — CID 66083792
4-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]piperazine-2,6-dione (PubChem CID 66083792) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is 4-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]piperazine-2,6-dione.
| Compound Name | 4-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66083792 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 4-[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]piperazine-2,6-dione |
| SMILES | Cc1cc(SCC(=O)N2CC(=O)NC(=O)C2)c(C)cc1Br |
| InChI | InChI=1S/C14H15BrN2O3S/c1-8-4-11(9(2)3-10(8)15)21-7-14(20)17-5-12(18)16-13(19)6-17/h3-4H,5-7H2,1-2H3,(H,16,18,19) |
| InChIKey | KRTAVERIPGODQI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|