C16H21BrN2O3S — CID 55348247
ethyl 4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazine-1-carboxylate (PubChem CID 55348247) has the molecular formula C16H21BrN2O3S and a molecular weight of 401.33 g/mol. Its IUPAC name is ethyl 4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55348247 |
| Molecular Formula | C16H21BrN2O3S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | ethyl 4-[2-(4-bromo-2-methylphenyl)sulfanylacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CSc2ccc(Br)cc2C)CC1 |
| InChI | InChI=1S/C16H21BrN2O3S/c1-3-22-16(21)19-8-6-18(7-9-19)15(20)11-23-14-5-4-13(17)10-12(14)2/h4-5,10H,3,6-9,11H2,1-2H3 |
| InChIKey | GHWQBBXECOUCBG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |