C18H26N3O3+ — CID 8596786
2-(4-benzoylpiperazin-1-ium-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 8596786) has the molecular formula C18H26N3O3+ and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 8596786 |
| Molecular Formula | C18H26N3O3+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccccc2)CC1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H25N3O3/c22-17(19-13-16-7-4-12-24-16)14-20-8-10-21(11-9-20)18(23)15-5-2-1-3-6-15/h1-3,5-6,16H,4,7-14H2,(H,19,22)/p+1/t16-/m0/s1 |
| InChIKey | RQOUDMAUCOKOIF-INIZCTEOSA-O |
| XLogP | -0.68 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |