C21H28N3O4S+ — CID 8692224
2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 8692224) has the molecular formula C21H28N3O4S+ and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 8692224 |
| Molecular Formula | C21H28N3O4S+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-(4-naphthalen-2-ylsulfonylpiperazin-1-ium-1-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C21H27N3O4S/c25-21(22-15-19-6-3-13-28-19)16-23-9-11-24(12-10-23)29(26,27)20-8-7-17-4-1-2-5-18(17)14-20/h1-2,4-5,7-8,14,19H,3,6,9-13,15-16H2,(H,22,25)/p+1/t19-/m1/s1 |
| InChIKey | UAUGIJFEKLCQAV-LJQANCHMSA-O |
| XLogP | 0.02 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |