C16H26N4O2+2 — CID 8596788
N-[[(2S)-oxolan-2-yl]methyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 8596788) has the molecular formula C16H26N4O2+2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8596788 |
| Molecular Formula | C16H26N4O2+2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2cccc[nH+]2)CC1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H24N4O2/c21-16(18-12-14-4-3-11-22-14)13-19-7-9-20(10-8-19)15-5-1-2-6-17-15/h1-2,5-6,14H,3-4,7-13H2,(H,18,21)/p+2/t14-/m0/s1 |
| InChIKey | MOAQIOULTLKTSR-AWEZNQCLSA-P |
| XLogP | -1.50 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |