C20H31N4O2S+ — CID 9218376
N-(2-ethylphenyl)-2-[4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9218376) has the molecular formula C20H31N4O2S+ and a molecular weight of 391.56 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9218376 |
| Molecular Formula | C20H31N4O2S+ |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[[(2R)-oxolan-2-yl]methylcarbamothioyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)C[NH+]1CCN(C(=S)NC[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C20H30N4O2S/c1-2-16-6-3-4-8-18(16)22-19(25)15-23-9-11-24(12-10-23)20(27)21-14-17-7-5-13-26-17/h3-4,6,8,17H,2,5,7,9-15H2,1H3,(H,21,27)(H,22,25)/p+1/t17-/m1/s1 |
| InChIKey | XQTSKXNWRKISQL-QGZVFWFLSA-O |
| XLogP | 0.44 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|