C11H22N3OS+ — CID 7276428
4-methyl-N-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 7276428) has the molecular formula C11H22N3OS+ and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-methyl-N-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-methyl-N-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 7276428 |
| Molecular Formula | C11H22N3OS+ |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 4-methyl-N-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | C[NH+]1CCN(C(=S)NC[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C11H21N3OS/c1-13-4-6-14(7-5-13)11(16)12-9-10-3-2-8-15-10/h10H,2-9H2,1H3,(H,12,16)/p+1/t10-/m0/s1 |
| InChIKey | VASOISAJWOEJGF-JTQLQIEISA-O |
| XLogP | -1.13 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|