C16H23N3O2S — CID 17374236
4-(3-hydroxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 17374236) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3-hydroxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17374236 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-(3-hydroxyphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | Oc1cccc(N2CCN(C(=S)NCC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C16H23N3O2S/c20-14-4-1-3-13(11-14)18-6-8-19(9-7-18)16(22)17-12-15-5-2-10-21-15/h1,3-4,11,15,20H,2,5-10,12H2,(H,17,22) |
| InChIKey | AIQZDUUDSZUWJA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|