C21H31N3O3 — CID 108960037
2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 108960037) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 108960037 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C(C)(C)C(=O)NCC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C21H31N3O3/c1-16-6-4-7-17(14-16)23-9-11-24(12-10-23)20(26)21(2,3)19(25)22-15-18-8-5-13-27-18/h4,6-7,14,18H,5,8-13,15H2,1-3H3,(H,22,25) |
| InChIKey | JYVFSRITXRWMPD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|