C19H29N3O2 — CID 108957034
2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-propylpropanamide (PubChem CID 108957034) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-propylpropanamide.
| Compound Name | 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-propylpropanamide |
|---|---|
| PubChem CID | 108957034 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)(C)C(=O)N1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C19H29N3O2/c1-5-9-20-17(23)19(3,4)18(24)22-12-10-21(11-13-22)16-8-6-7-15(2)14-16/h6-8,14H,5,9-13H2,1-4H3,(H,20,23) |
| InChIKey | FOOOOPFUVMDIRC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|