C19H27N3O3 — CID 108943652
3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 108943652) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 108943652 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-[4-(3-methylphenyl)piperazin-1-yl]-3-oxo-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | Cc1cccc(N2CCN(C(=O)CC(=O)NCC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C19H27N3O3/c1-15-4-2-5-16(12-15)21-7-9-22(10-8-21)19(24)13-18(23)20-14-17-6-3-11-25-17/h2,4-5,12,17H,3,6-11,13-14H2,1H3,(H,20,23) |
| InChIKey | JYVFVNRMHWZHSY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|