C17H25N3O2S — CID 133185630
4-[(3-hydroxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 133185630) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 4-[(3-hydroxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3-hydroxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 133185630 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-[(3-hydroxyphenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | Oc1cccc(CN2CCN(C(=S)NCC3CCCO3)CC2)c1 |
| InChI | InChI=1S/C17H25N3O2S/c21-15-4-1-3-14(11-15)13-19-6-8-20(9-7-19)17(23)18-12-16-5-2-10-22-16/h1,3-4,11,16,21H,2,5-10,12-13H2,(H,18,23) |
| InChIKey | KNDOXHPAHOMWCS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|