C20H31N3O4S — CID 100570939
N-[[(2R)-oxolan-2-yl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbothioamide (PubChem CID 100570939) has the molecular formula C20H31N3O4S and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 100570939 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1-carbothioamide |
| SMILES | COc1cc(CN2CCN(C(=S)NC[C@H]3CCCO3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H31N3O4S/c1-24-17-11-15(12-18(25-2)19(17)26-3)14-22-6-8-23(9-7-22)20(28)21-13-16-5-4-10-27-16/h11-12,16H,4-10,13-14H2,1-3H3,(H,21,28)/t16-/m1/s1 |
| InChIKey | JZQCLTFKQYVSBQ-MRXNPFEDSA-N |
| XLogP | 1.88 |
| TPSA | 55.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|