C17H29N5OS — CID 17269940
4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 17269940) has the molecular formula C17H29N5OS and a molecular weight of 351.52 g/mol. Its IUPAC name is 4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17269940 |
| Molecular Formula | C17H29N5OS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 4-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | CCn1ncc(CN2CCN(C(=S)NCC3CCCO3)CC2)c1C |
| InChI | InChI=1S/C17H29N5OS/c1-3-22-14(2)15(11-19-22)13-20-6-8-21(9-7-20)17(24)18-12-16-5-4-10-23-16/h11,16H,3-10,12-13H2,1-2H3,(H,18,24) |
| InChIKey | WAAJSWNBYWPXHZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|