C17H23Cl2N3OS — CID 19574555
4-[(3,4-dichlorophenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 19574555) has the molecular formula C17H23Cl2N3OS and a molecular weight of 388.36 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19574555 |
| Molecular Formula | C17H23Cl2N3OS |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | S=C(NCC1CCCO1)N1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23Cl2N3OS/c18-15-4-3-13(10-16(15)19)12-21-5-7-22(8-6-21)17(24)20-11-14-2-1-9-23-14/h3-4,10,14H,1-2,5-9,11-12H2,(H,20,24) |
| InChIKey | HKYASELMXNYIKU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|