C16H24N3OS+ — CID 6951956
N-[[(2R)-oxolan-2-yl]methyl]-4-phenylpiperazin-4-ium-1-carbothioamide (PubChem CID 6951956) has the molecular formula C16H24N3OS+ and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-4-phenylpiperazin-4-ium-1-carbothioamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-4-phenylpiperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 6951956 |
| Molecular Formula | C16H24N3OS+ |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-4-phenylpiperazin-4-ium-1-carbothioamide |
| SMILES | S=C(NC[C@H]1CCCO1)N1CC[NH+](c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23N3OS/c21-16(17-13-15-7-4-12-20-15)19-10-8-18(9-11-19)14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H,17,21)/p+1/t15-/m1/s1 |
| InChIKey | BRJQOBOKVKFRGD-OAHLLOKOSA-O |
| XLogP | 0.57 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|