C21H27N3OS — CID 9097502
4-(naphthalen-1-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide (PubChem CID 9097502) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 4-(naphthalen-1-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide.
| Compound Name | 4-(naphthalen-1-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9097502 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-(naphthalen-1-ylmethyl)-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide |
| SMILES | S=C(NC[C@@H]1CCCO1)N1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C21H27N3OS/c26-21(22-15-19-8-4-14-25-19)24-12-10-23(11-13-24)16-18-7-3-6-17-5-1-2-9-20(17)18/h1-3,5-7,9,19H,4,8,10-16H2,(H,22,26)/t19-/m0/s1 |
| InChIKey | VMKJIGXBFCVSNS-IBGZPJMESA-N |
| XLogP | 3.01 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|