C17H24ClN3OS — CID 19655033
4-(5-chloro-2-methylphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 19655033) has the molecular formula C17H24ClN3OS and a molecular weight of 353.92 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19655033 |
| Molecular Formula | C17H24ClN3OS |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=S)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C17H24ClN3OS/c1-13-4-5-14(18)11-16(13)20-6-8-21(9-7-20)17(23)19-12-15-3-2-10-22-15/h4-5,11,15H,2-3,6-10,12H2,1H3,(H,19,23) |
| InChIKey | OMLYAPJFONDERB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|