C18H23ClN4OS2 — CID 2795731
4-(6-chloro-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)-1,4-diazepane-1-carbothioamide (PubChem CID 2795731) has the molecular formula C18H23ClN4OS2 and a molecular weight of 411.00 g/mol. Its IUPAC name is 4-(6-chloro-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-(6-chloro-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 2795731 |
| Molecular Formula | C18H23ClN4OS2 |
| Molecular Weight | 411.00 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-(6-chloro-1,3-benzothiazol-2-yl)-N-(oxolan-2-ylmethyl)-1,4-diazepane-1-carbothioamide |
| SMILES | S=C(NCC1CCCO1)N1CCCN(c2nc3ccc(Cl)cc3s2)CC1 |
| InChI | InChI=1S/C18H23ClN4OS2/c19-13-4-5-15-16(11-13)26-18(21-15)23-7-2-6-22(8-9-23)17(25)20-12-14-3-1-10-24-14/h4-5,11,14H,1-3,6-10,12H2,(H,20,25) |
| InChIKey | ZYSVSZJOADYMOL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.00 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|