C16H22N4S2 — CID 108781518
N-ethyl-4-(6-ethyl-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide (PubChem CID 108781518) has the molecular formula C16H22N4S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is N-ethyl-4-(6-ethyl-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide.
| Compound Name | N-ethyl-4-(6-ethyl-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 108781518 |
| Molecular Formula | C16H22N4S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-ethyl-4-(6-ethyl-1,3-benzothiazol-2-yl)piperazine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCN(c2nc3ccc(CC)cc3s2)CC1 |
| InChI | InChI=1S/C16H22N4S2/c1-3-12-5-6-13-14(11-12)22-16(18-13)20-9-7-19(8-10-20)15(21)17-4-2/h5-6,11H,3-4,7-10H2,1-2H3,(H,17,21) |
| InChIKey | CGKSUKRZSIWOMB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|