C14H19N3O2S2 — CID 108781505
6-ethyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-benzothiazole (PubChem CID 108781505) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 6-ethyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-benzothiazole.
| Compound Name | 6-ethyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 108781505 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 6-ethyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-benzothiazole |
| SMILES | CCc1ccc2nc(N3CCN(S(C)(=O)=O)CC3)sc2c1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-3-11-4-5-12-13(10-11)20-14(15-12)16-6-8-17(9-7-16)21(2,18)19/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | WTDNRWJUAWIFDU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |