C18H25N3OS — CID 172901090
6-ethyl-2-[4-(oxan-4-yl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 172901090) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 6-ethyl-2-[4-(oxan-4-yl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-ethyl-2-[4-(oxan-4-yl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 172901090 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 6-ethyl-2-[4-(oxan-4-yl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | CCc1ccc2nc(N3CCN(C4CCOCC4)CC3)sc2c1 |
| InChI | InChI=1S/C18H25N3OS/c1-2-14-3-4-16-17(13-14)23-18(19-16)21-9-7-20(8-10-21)15-5-11-22-12-6-15/h3-4,13,15H,2,5-12H2,1H3 |
| InChIKey | OFBWFGZUMUTSDV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |