C20H23N3S — CID 121081540
6-ethyl-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 121081540) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 6-ethyl-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-ethyl-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 121081540 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 6-ethyl-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | CCc1ccc2nc(N3CCN(c4cccc(C)c4)CC3)sc2c1 |
| InChI | InChI=1S/C20H23N3S/c1-3-16-7-8-18-19(14-16)24-20(21-18)23-11-9-22(10-12-23)17-6-4-5-15(2)13-17/h4-8,13-14H,3,9-12H2,1-2H3 |
| InChIKey | BXESXSNZPNWEIF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |