C20H23N3OS — CID 121081648
4-ethoxy-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 121081648) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-ethoxy-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 4-ethoxy-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 121081648 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-ethoxy-2-[4-(3-methylphenyl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | CCOc1cccc2sc(N3CCN(c4cccc(C)c4)CC3)nc12 |
| InChI | InChI=1S/C20H23N3OS/c1-3-24-17-8-5-9-18-19(17)21-20(25-18)23-12-10-22(11-13-23)16-7-4-6-15(2)14-16/h4-9,14H,3,10-13H2,1-2H3 |
| InChIKey | AXMLAJQHNFUBEN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |