C24H27N3O4S — CID 43982467
(Z)-3-(3,4-dimethoxyphenyl)-1-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 43982467) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is (Z)-3-(3,4-dimethoxyphenyl)-1-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(3,4-dimethoxyphenyl)-1-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 43982467 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (Z)-3-(3,4-dimethoxyphenyl)-1-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1cccc2sc(N3CCN(C(=O)/C=C\c4ccc(OC)c(OC)c4)CC3)nc12 |
| InChI | InChI=1S/C24H27N3O4S/c1-4-31-19-6-5-7-21-23(19)25-24(32-21)27-14-12-26(13-15-27)22(28)11-9-17-8-10-18(29-2)20(16-17)30-3/h5-11,16H,4,12-15H2,1-3H3/b11-9- |
| InChIKey | XFIIBGCQYJLFAH-LUAWRHEFSA-N |
| XLogP | 4.07 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|