C25H29N3O3S — CID 46612671
(E)-1-[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 46612671) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is (E)-1-[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46612671 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (E)-1-[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCN(C(C)c3nc4ccccc4s3)CC2)cc1OC |
| InChI | InChI=1S/C25H29N3O3S/c1-4-31-21-11-9-19(17-22(21)30-3)10-12-24(29)28-15-13-27(14-16-28)18(2)25-26-20-7-5-6-8-23(20)32-25/h5-12,17-18H,4,13-16H2,1-3H3/b12-10+ |
| InChIKey | SIQFUEUNPXETTL-ZRDIBKRKSA-N |
| XLogP | 4.62 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|