About 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole
2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole (PubChem CID 16941357) has the molecular formula C21H22N4O2S2
and a molecular weight of 426.57 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole |
| PubChem CID | 16941357 |
| Molecular Formula | C21H22N4O2S2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole |
| SMILES | CCOc1cccc2sc(N3CCN(c4nc5ccc(OC)cc5s4)CC3)nc12 |
| InChI | InChI=1S/C21H22N4O2S2/c1-3-27-16-5-4-6-17-19(16)23-21(28-17)25-11-9-24(10-12-25)20-22-15-8-7-14(26-2)13-18(15)29-20/h4-8,13H,3,9-12H2,1-2H3 |
| InChIKey | ITWDWEIPTGNYQU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole?
The IUPAC name of 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole (CID 16941357) is 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole.
What is the SMILES notation for 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole?
The canonical SMILES for 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole is CCOc1cccc2sc(N3CCN(c4nc5ccc(OC)cc5s4)CC3)nc12.
What is the InChIKey of 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole?
The InChIKey is ITWDWEIPTGNYQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O2S2/c1-3-27-16-5-4-6-17-19(16)23-21(28-17)25-11-9-24(10-12-25)20-22-15-8-7-14(26-2)13-18(15)29-20/h4-8,13H,3,9-12H2,1-2H3.
What are the key properties of 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole?
2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole has a molecular weight of 426.57 g/mol, XLogP of 4.64, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-ethoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-6-methoxy-1,3-benzothiazole is sourced from PubChem (CID 16941357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).