C19H19Cl2N3S — CID 121083428
2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-6-ethyl-1,3-benzothiazole (PubChem CID 121083428) has the molecular formula C19H19Cl2N3S and a molecular weight of 392.36 g/mol. Its IUPAC name is 2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-6-ethyl-1,3-benzothiazole.
| Compound Name | 2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-6-ethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 121083428 |
| Molecular Formula | C19H19Cl2N3S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[4-(2,3-dichlorophenyl)piperazin-1-yl]-6-ethyl-1,3-benzothiazole |
| SMILES | CCc1ccc2nc(N3CCN(c4cccc(Cl)c4Cl)CC3)sc2c1 |
| InChI | InChI=1S/C19H19Cl2N3S/c1-2-13-6-7-15-17(12-13)25-19(22-15)24-10-8-23(9-11-24)16-5-3-4-14(20)18(16)21/h3-7,12H,2,8-11H2,1H3 |
| InChIKey | IKKKDNRJUQCZOH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |