About 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide
1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 171691603) has the molecular formula C17H23N3OS
and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide |
| PubChem CID | 171691603 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CCc1ccc2nc(N3CCC(C(=O)N(C)C)CC3)sc2c1 |
| InChI | InChI=1S/C17H23N3OS/c1-4-12-5-6-14-15(11-12)22-17(18-14)20-9-7-13(8-10-20)16(21)19(2)3/h5-6,11,13H,4,7-10H2,1-3H3 |
| InChIKey | BDOOAXFGOAMZEK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide?
The IUPAC name of 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide (CID 171691603) is 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide.
What is the SMILES notation for 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide?
The canonical SMILES for 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide is CCc1ccc2nc(N3CCC(C(=O)N(C)C)CC3)sc2c1.
What is the InChIKey of 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide?
The InChIKey is BDOOAXFGOAMZEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3OS/c1-4-12-5-6-14-15(11-12)22-17(18-14)20-9-7-13(8-10-20)16(21)19(2)3/h5-6,11,13H,4,7-10H2,1-3H3.
What are the key properties of 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide?
1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide has a molecular weight of 317.46 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-ethyl-1,3-benzothiazol-2-yl)-N,N-dimethylpiperidine-4-carboxamide is sourced from PubChem (CID 171691603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).