C11H11ClN2S — CID 7110134
6-chloro-2-pyrrolidin-1-yl-1,3-benzothiazole (PubChem CID 7110134) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 6-chloro-2-pyrrolidin-1-yl-1,3-benzothiazole.
| Compound Name | 6-chloro-2-pyrrolidin-1-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 7110134 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 6-chloro-2-pyrrolidin-1-yl-1,3-benzothiazole |
| SMILES | Clc1ccc2nc(N3CCCC3)sc2c1 |
| InChI | InChI=1S/C11H11ClN2S/c12-8-3-4-9-10(7-8)15-11(13-9)14-5-1-2-6-14/h3-4,7H,1-2,5-6H2 |
| InChIKey | CBQNDRJFHDVCEU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |