C15H16ClN3O4S — CID 68654648
but-2-enedioic acid;6-chloro-2-piperazin-1-yl-1,3-benzothiazole (PubChem CID 68654648) has the molecular formula C15H16ClN3O4S and a molecular weight of 369.83 g/mol. Its IUPAC name is but-2-enedioic acid;6-chloro-2-piperazin-1-yl-1,3-benzothiazole.
| Compound Name | but-2-enedioic acid;6-chloro-2-piperazin-1-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 68654648 |
| Molecular Formula | C15H16ClN3O4S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | but-2-enedioic acid;6-chloro-2-piperazin-1-yl-1,3-benzothiazole |
| SMILES | Clc1ccc2nc(N3CCNCC3)sc2c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H12ClN3S.C4H4O4/c12-8-1-2-9-10(7-8)16-11(14-9)15-5-3-13-4-6-15;5-3(6)1-2-4(7)8/h1-2,7,13H,3-6H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | PROJMLURZOHATQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|