C19H17ClN2O2S — CID 8610906
(2-piperidin-1-yl-1,3-benzothiazol-6-yl) 4-chlorobenzoate (PubChem CID 8610906) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is (2-piperidin-1-yl-1,3-benzothiazol-6-yl) 4-chlorobenzoate.
| Compound Name | (2-piperidin-1-yl-1,3-benzothiazol-6-yl) 4-chlorobenzoate |
|---|---|
| PubChem CID | 8610906 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (2-piperidin-1-yl-1,3-benzothiazol-6-yl) 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc2nc(N3CCCCC3)sc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2O2S/c20-14-6-4-13(5-7-14)18(23)24-15-8-9-16-17(12-15)25-19(21-16)22-10-2-1-3-11-22/h4-9,12H,1-3,10-11H2 |
| InChIKey | OHAACIDPWPYDPS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|