C22H24N3O3S+ — CID 8611185
[2-(4-ethylpiperazin-4-ium-1-yl)-1,3-benzothiazol-6-yl] 4-acetylbenzoate (PubChem CID 8611185) has the molecular formula C22H24N3O3S+ and a molecular weight of 410.52 g/mol. Its IUPAC name is [2-(4-ethylpiperazin-4-ium-1-yl)-1,3-benzothiazol-6-yl] 4-acetylbenzoate.
| Compound Name | [2-(4-ethylpiperazin-4-ium-1-yl)-1,3-benzothiazol-6-yl] 4-acetylbenzoate |
|---|---|
| PubChem CID | 8611185 |
| Molecular Formula | C22H24N3O3S+ |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-(4-ethylpiperazin-4-ium-1-yl)-1,3-benzothiazol-6-yl] 4-acetylbenzoate |
| SMILES | CC[NH+]1CCN(c2nc3ccc(OC(=O)c4ccc(C(C)=O)cc4)cc3s2)CC1 |
| InChI | InChI=1S/C22H23N3O3S/c1-3-24-10-12-25(13-11-24)22-23-19-9-8-18(14-20(19)29-22)28-21(27)17-6-4-16(5-7-17)15(2)26/h4-9,14H,3,10-13H2,1-2H3/p+1 |
| InChIKey | BEKHJAARADRFLF-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|