C23H26N4O4S2 — CID 16873960
[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 16873960) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16873960 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CN1CCN(c2nc3ccc(OC(=O)c4ccc(S(=O)(=O)N5CCCC5)cc4)cc3s2)CC1 |
| InChI | InChI=1S/C23H26N4O4S2/c1-25-12-14-26(15-13-25)23-24-20-9-6-18(16-21(20)32-23)31-22(28)17-4-7-19(8-5-17)33(29,30)27-10-2-3-11-27/h4-9,16H,2-3,10-15H2,1H3 |
| InChIKey | LOGFSTLJAQMSBQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|