C24H27N3O4S2 — CID 16874096
(2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-(3-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 16874096) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-(3-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-(3-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16874096 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (2-pyrrolidin-1-yl-1,3-benzothiazol-6-yl) 4-(3-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(C(=O)Oc3ccc4nc(N5CCCC5)sc4c3)cc2)C1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-17-5-4-14-27(16-17)33(29,30)20-9-6-18(7-10-20)23(28)31-19-8-11-21-22(15-19)32-24(25-21)26-12-2-3-13-26/h6-11,15,17H,2-5,12-14,16H2,1H3 |
| InChIKey | YXTOZGQDWMALID-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|