C30H32N4O5S2 — CID 43981596
[2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate (PubChem CID 43981596) has the molecular formula C30H32N4O5S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate.
| Compound Name | [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 43981596 |
| Molecular Formula | C30H32N4O5S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)Oc3ccc4nc(N5CCN(c6ccccc6)CC5)sc4c3)cc2)CC(C)O1 |
| InChI | InChI=1S/C30H32N4O5S2/c1-21-19-34(20-22(2)38-21)41(36,37)26-11-8-23(9-12-26)29(35)39-25-10-13-27-28(18-25)40-30(31-27)33-16-14-32(15-17-33)24-6-4-3-5-7-24/h3-13,18,21-22H,14-17,19-20H2,1-2H3 |
| InChIKey | IHRNHCAQOMRIBW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|