C26H25N3O5S2 — CID 16830073
(2-morpholin-4-yl-1,3-benzothiazol-6-yl) 4-[benzyl(methyl)sulfamoyl]benzoate (PubChem CID 16830073) has the molecular formula C26H25N3O5S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is (2-morpholin-4-yl-1,3-benzothiazol-6-yl) 4-[benzyl(methyl)sulfamoyl]benzoate.
| Compound Name | (2-morpholin-4-yl-1,3-benzothiazol-6-yl) 4-[benzyl(methyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 16830073 |
| Molecular Formula | C26H25N3O5S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | (2-morpholin-4-yl-1,3-benzothiazol-6-yl) 4-[benzyl(methyl)sulfamoyl]benzoate |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)Oc2ccc3nc(N4CCOCC4)sc3c2)cc1 |
| InChI | InChI=1S/C26H25N3O5S2/c1-28(18-19-5-3-2-4-6-19)36(31,32)22-10-7-20(8-11-22)25(30)34-21-9-12-23-24(17-21)35-26(27-23)29-13-15-33-16-14-29/h2-12,17H,13-16,18H2,1H3 |
| InChIKey | MXUINOBRCOXYSJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|