C31H27N3O2S — CID 43981608
[2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate (PubChem CID 43981608) has the molecular formula C31H27N3O2S and a molecular weight of 505.64 g/mol. Its IUPAC name is [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate.
| Compound Name | [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate |
|---|---|
| PubChem CID | 43981608 |
| Molecular Formula | C31H27N3O2S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-benzylbenzoate |
| SMILES | O=C(Oc1ccc2nc(N3CCN(c4ccccc4)CC3)sc2c1)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H27N3O2S/c35-30(25-13-11-24(12-14-25)21-23-7-3-1-4-8-23)36-27-15-16-28-29(22-27)37-31(32-28)34-19-17-33(18-20-34)26-9-5-2-6-10-26/h1-16,22H,17-21H2 |
| InChIKey | CISZBPJNHLJMHG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|