C19H18ClN3O2S — CID 8610919
[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-chlorobenzoate (PubChem CID 8610919) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-chlorobenzoate.
| Compound Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 8610919 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-chlorobenzoate |
| SMILES | CN1CCN(c2nc3ccc(OC(=O)c4ccc(Cl)cc4)cc3s2)CC1 |
| InChI | InChI=1S/C19H18ClN3O2S/c1-22-8-10-23(11-9-22)19-21-16-7-6-15(12-17(16)26-19)25-18(24)13-2-4-14(20)5-3-13/h2-7,12H,8-11H2,1H3 |
| InChIKey | SGESOPVKKDMUBM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|