C25H28N4O4S2 — CID 16874070
[2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-[bis(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 16874070) has the molecular formula C25H28N4O4S2 and a molecular weight of 512.66 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-[bis(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-[bis(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 16874070 |
| Molecular Formula | C25H28N4O4S2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 4-[bis(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)Oc2ccc3nc(N4CCN(C)CC4)sc3c2)cc1 |
| InChI | InChI=1S/C25H28N4O4S2/c1-4-12-29(13-5-2)35(31,32)21-9-6-19(7-10-21)24(30)33-20-8-11-22-23(18-20)34-25(26-22)28-16-14-27(3)15-17-28/h4-11,18H,1-2,12-17H2,3H3 |
| InChIKey | SLUZAUYLZDGUST-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|