C25H28N4O4S2 — CID 41116102
4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-N,N-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 41116102) has the molecular formula C25H28N4O4S2 and a molecular weight of 512.66 g/mol. Its IUPAC name is 4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-N,N-bis(prop-2-enyl)benzenesulfonamide.
| Compound Name | 4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-N,N-bis(prop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 41116102 |
| Molecular Formula | C25H28N4O4S2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazine-1-carbonyl]-N,N-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)N2CCN(c3nc4c(OC)cccc4s3)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O4S2/c1-4-13-29(14-5-2)35(31,32)20-11-9-19(10-12-20)24(30)27-15-17-28(18-16-27)25-26-23-21(33-3)7-6-8-22(23)34-25/h4-12H,1-2,13-18H2,3H3 |
| InChIKey | NUVRSYJHCPKRTH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|