C24H29N3O3S — CID 41116108
[4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone (PubChem CID 41116108) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is [4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone.
| Compound Name | [4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone |
|---|---|
| PubChem CID | 41116108 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | [4-(4-methoxy-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone |
| SMILES | CCCCCOc1ccc(C(=O)N2CCN(c3nc4c(OC)cccc4s3)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-3-4-5-17-30-19-11-9-18(10-12-19)23(28)26-13-15-27(16-14-26)24-25-22-20(29-2)7-6-8-21(22)31-24/h6-12H,3-5,13-17H2,1-2H3 |
| InChIKey | RHWYSHKIZZMFMK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|