C20H28N4O2S — CID 108753270
(4-hexoxyphenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone (PubChem CID 108753270) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is (4-hexoxyphenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone.
| Compound Name | (4-hexoxyphenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108753270 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (4-hexoxyphenyl)-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]methanone |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCN(c3nnc(C)s3)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O2S/c1-3-4-5-6-15-26-18-9-7-17(8-10-18)19(25)23-11-13-24(14-12-23)20-22-21-16(2)27-20/h7-10H,3-6,11-15H2,1-2H3 |
| InChIKey | VZHWXABWWUYTDJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|