C23H25F2N3O2S — CID 41116427
[4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone (PubChem CID 41116427) has the molecular formula C23H25F2N3O2S and a molecular weight of 445.54 g/mol. Its IUPAC name is [4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone.
| Compound Name | [4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone |
|---|---|
| PubChem CID | 41116427 |
| Molecular Formula | C23H25F2N3O2S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | [4-(4,6-difluoro-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-pentoxyphenyl)methanone |
| SMILES | CCCCCOc1ccc(C(=O)N2CCN(c3nc4c(F)cc(F)cc4s3)CC2)cc1 |
| InChI | InChI=1S/C23H25F2N3O2S/c1-2-3-4-13-30-18-7-5-16(6-8-18)22(29)27-9-11-28(12-10-27)23-26-21-19(25)14-17(24)15-20(21)31-23/h5-8,14-15H,2-4,9-13H2,1H3 |
| InChIKey | HMENGWONCKHOBM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|