C17H21ClN4O2S — CID 108753352
4-(4-chlorophenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one (PubChem CID 108753352) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-chlorophenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108753352 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-(4-chlorophenoxy)-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one |
| SMILES | Cc1nnc(N2CCN(C(=O)CCCOc3ccc(Cl)cc3)CC2)s1 |
| InChI | InChI=1S/C17H21ClN4O2S/c1-13-19-20-17(25-13)22-10-8-21(9-11-22)16(23)3-2-12-24-15-6-4-14(18)5-7-15/h4-7H,2-3,8-12H2,1H3 |
| InChIKey | VODQJEZGPFGOEJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|